C12H18BrN3O — CID 106997842
5-bromo-N-(2,2-dimethylcyclopentyl)-4-methoxypyrimidin-2-amine (PubChem CID 106997842) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethylcyclopentyl)-4-methoxypyrimidin-2-amine.
| Compound Name | 5-bromo-N-(2,2-dimethylcyclopentyl)-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 106997842 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-bromo-N-(2,2-dimethylcyclopentyl)-4-methoxypyrimidin-2-amine |
| SMILES | COc1nc(NC2CCCC2(C)C)ncc1Br |
| InChI | InChI=1S/C12H18BrN3O/c1-12(2)6-4-5-9(12)15-11-14-7-8(13)10(16-11)17-3/h7,9H,4-6H2,1-3H3,(H,14,15,16) |
| InChIKey | HYVVMEZPDFALNR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |