C14H23N3O — CID 112638202
N-(2,2-dimethylcyclopentyl)-4-propoxypyrimidin-2-amine (PubChem CID 112638202) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-4-propoxypyrimidin-2-amine.
| Compound Name | N-(2,2-dimethylcyclopentyl)-4-propoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 112638202 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-4-propoxypyrimidin-2-amine |
| SMILES | CCCOc1ccnc(NC2CCCC2(C)C)n1 |
| InChI | InChI=1S/C14H23N3O/c1-4-10-18-12-7-9-15-13(17-12)16-11-6-5-8-14(11,2)3/h7,9,11H,4-6,8,10H2,1-3H3,(H,15,16,17) |
| InChIKey | NXXFEAOYYPYCRV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |