C13H22N4O — CID 112638834
2-cyclopropyl-2-N-(4-propoxypyrimidin-2-yl)propane-1,2-diamine (PubChem CID 112638834) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-cyclopropyl-2-N-(4-propoxypyrimidin-2-yl)propane-1,2-diamine.
| Compound Name | 2-cyclopropyl-2-N-(4-propoxypyrimidin-2-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 112638834 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-cyclopropyl-2-N-(4-propoxypyrimidin-2-yl)propane-1,2-diamine |
| SMILES | CCCOc1ccnc(NC(C)(CN)C2CC2)n1 |
| InChI | InChI=1S/C13H22N4O/c1-3-8-18-11-6-7-15-12(16-11)17-13(2,9-14)10-4-5-10/h6-7,10H,3-5,8-9,14H2,1-2H3,(H,15,16,17) |
| InChIKey | PSIDGVHCTRRPSD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |