C15H26N4O2 — CID 115975400
N-[2-(4-aminocyclohexyl)oxyethyl]-4-propoxypyrimidin-2-amine (PubChem CID 115975400) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-4-propoxypyrimidin-2-amine.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-4-propoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115975400 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-4-propoxypyrimidin-2-amine |
| SMILES | CCCOc1ccnc(NCCOC2CCC(N)CC2)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-2-10-21-14-7-8-17-15(19-14)18-9-11-20-13-5-3-12(16)4-6-13/h7-8,12-13H,2-6,9-11,16H2,1H3,(H,17,18,19) |
| InChIKey | REDVXJNJAPRCSF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|