C9H15N3O2 — CID 80860272
2-[2-(propylamino)pyrimidin-4-yl]oxyethanol (PubChem CID 80860272) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[2-(propylamino)pyrimidin-4-yl]oxyethanol.
| Compound Name | 2-[2-(propylamino)pyrimidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 80860272 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-[2-(propylamino)pyrimidin-4-yl]oxyethanol |
| SMILES | CCCNc1nccc(OCCO)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-4-10-9-11-5-3-8(12-9)14-7-6-13/h3,5,13H,2,4,6-7H2,1H3,(H,10,11,12) |
| InChIKey | LOOAIFQIYLIPFA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |