C11H19N3O2 — CID 112638477
3-[(4-propoxypyrimidin-2-yl)amino]butan-1-ol (PubChem CID 112638477) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[(4-propoxypyrimidin-2-yl)amino]butan-1-ol.
| Compound Name | 3-[(4-propoxypyrimidin-2-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 112638477 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-[(4-propoxypyrimidin-2-yl)amino]butan-1-ol |
| SMILES | CCCOc1ccnc(NC(C)CCO)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-3-8-16-10-4-6-12-11(14-10)13-9(2)5-7-15/h4,6,9,15H,3,5,7-8H2,1-2H3,(H,12,13,14) |
| InChIKey | OFLGIKWOSKAFSF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |