C8H13N3O2 — CID 80865476
3-[2-(methylamino)pyrimidin-4-yl]oxypropan-1-ol (PubChem CID 80865476) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-[2-(methylamino)pyrimidin-4-yl]oxypropan-1-ol.
| Compound Name | 3-[2-(methylamino)pyrimidin-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 80865476 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-[2-(methylamino)pyrimidin-4-yl]oxypropan-1-ol |
| SMILES | CNc1nccc(OCCCO)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-9-8-10-4-3-7(11-8)13-6-2-5-12/h3-4,12H,2,5-6H2,1H3,(H,9,10,11) |
| InChIKey | HMVNSBQNMKGYJS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|