C12H21N3O3 — CID 106248135
1-methoxy-4-[(4-propoxypyrimidin-2-yl)amino]butan-2-ol (PubChem CID 106248135) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-methoxy-4-[(4-propoxypyrimidin-2-yl)amino]butan-2-ol.
| Compound Name | 1-methoxy-4-[(4-propoxypyrimidin-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 106248135 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-methoxy-4-[(4-propoxypyrimidin-2-yl)amino]butan-2-ol |
| SMILES | CCCOc1ccnc(NCCC(O)COC)n1 |
| InChI | InChI=1S/C12H21N3O3/c1-3-8-18-11-5-7-14-12(15-11)13-6-4-10(16)9-17-2/h5,7,10,16H,3-4,6,8-9H2,1-2H3,(H,13,14,15) |
| InChIKey | MRKQDMLXMWGCCM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |