C12H22N4O — CID 112638691
3-methyl-1-N-(4-propoxypyrimidin-2-yl)butane-1,2-diamine (PubChem CID 112638691) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-methyl-1-N-(4-propoxypyrimidin-2-yl)butane-1,2-diamine.
| Compound Name | 3-methyl-1-N-(4-propoxypyrimidin-2-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 112638691 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 3-methyl-1-N-(4-propoxypyrimidin-2-yl)butane-1,2-diamine |
| SMILES | CCCOc1ccnc(NCC(N)C(C)C)n1 |
| InChI | InChI=1S/C12H22N4O/c1-4-7-17-11-5-6-14-12(16-11)15-8-10(13)9(2)3/h5-6,9-10H,4,7-8,13H2,1-3H3,(H,14,15,16) |
| InChIKey | SDFVWZFCIHCLQD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |