C9H13N3O — CID 94830398
N-cyclopropyl-4-ethoxypyrimidin-2-amine (PubChem CID 94830398) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-cyclopropyl-4-ethoxypyrimidin-2-amine.
| Compound Name | N-cyclopropyl-4-ethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 94830398 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-cyclopropyl-4-ethoxypyrimidin-2-amine |
| SMILES | CCOc1ccnc(NC2CC2)n1 |
| InChI | InChI=1S/C9H13N3O/c1-2-13-8-5-6-10-9(12-8)11-7-3-4-7/h5-7H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | NCJYLBGOAYFOGJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |