C12H19N3O2 — CID 112637423
4-ethoxy-N-(2-methoxycyclopentyl)pyrimidin-2-amine (PubChem CID 112637423) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-ethoxy-N-(2-methoxycyclopentyl)pyrimidin-2-amine.
| Compound Name | 4-ethoxy-N-(2-methoxycyclopentyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112637423 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-ethoxy-N-(2-methoxycyclopentyl)pyrimidin-2-amine |
| SMILES | CCOc1ccnc(NC2CCCC2OC)n1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-17-11-7-8-13-12(15-11)14-9-5-4-6-10(9)16-2/h7-10H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | BGXSZIOEQWALMQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |