C7H10FN5 — CID 80931605
N-cyclopropyl-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 80931605) has the molecular formula C7H10FN5 and a molecular weight of 183.19 g/mol. Its IUPAC name is N-cyclopropyl-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-cyclopropyl-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80931605 |
| Molecular Formula | C7H10FN5 |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-cyclopropyl-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(F)c(NC2CC2)n1 |
| InChI | InChI=1S/C7H10FN5/c8-5-3-10-7(13-9)12-6(5)11-4-1-2-4/h3-4H,1-2,9H2,(H2,10,11,12,13) |
| InChIKey | MVYRGOHQIMRQOQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|