C13H23N5 — CID 80929757
N-(2,2-dimethylcyclopentyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine (PubChem CID 80929757) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2,2-dimethylcyclopentyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80929757 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
| SMILES | CCc1c(NN)ncnc1NC1CCCC1(C)C |
| InChI | InChI=1S/C13H23N5/c1-4-9-11(15-8-16-12(9)18-14)17-10-6-5-7-13(10,2)3/h8,10H,4-7,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | ILDRMYBKHVTQMR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|