C16H27N5 — CID 80909037
5-ethyl-6-hydrazinyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidin-4-amine (PubChem CID 80909037) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 5-ethyl-6-hydrazinyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidin-4-amine.
| Compound Name | 5-ethyl-6-hydrazinyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80909037 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 5-ethyl-6-hydrazinyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidin-4-amine |
| SMILES | CCc1c(NN)ncnc1NC1C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C16H27N5/c1-5-11-12(18-9-19-13(11)21-17)20-14-15(2,3)10-6-7-16(14,4)8-10/h9-10,14H,5-8,17H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | YQBHNRPPBDEGND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|