C14H24N6 — CID 80917975
6-hydrazinyl-4-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4-diamine (PubChem CID 80917975) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80917975 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6-hydrazinyl-4-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4-diamine |
| SMILES | CC12CCC(C1)C(C)(C)C2Nc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C14H24N6/c1-13(2)8-4-5-14(3,7-8)11(13)17-9-6-10(20-16)19-12(15)18-9/h6,8,11H,4-5,7,16H2,1-3H3,(H4,15,17,18,19,20) |
| InChIKey | ZBBIAISPTGVBMN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|