C17H25N3S — CID 114767729
2-methyl-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbothioamide (PubChem CID 114767729) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is 2-methyl-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbothioamide.
| Compound Name | 2-methyl-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114767729 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-methyl-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(NC2C3(C)CCC(C3)C2(C)C)n1 |
| InChI | InChI=1S/C17H25N3S/c1-10-7-11(14(18)21)8-13(19-10)20-15-16(2,3)12-5-6-17(15,4)9-12/h7-8,12,15H,5-6,9H2,1-4H3,(H2,18,21)(H,19,20) |
| InChIKey | YCAHNETUEWDOCO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|