C12H17N3OS2 — CID 114767979
2-methyl-6-[(1-oxothian-4-yl)amino]pyridine-4-carbothioamide (PubChem CID 114767979) has the molecular formula C12H17N3OS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-methyl-6-[(1-oxothian-4-yl)amino]pyridine-4-carbothioamide.
| Compound Name | 2-methyl-6-[(1-oxothian-4-yl)amino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114767979 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-methyl-6-[(1-oxothian-4-yl)amino]pyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(NC2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C12H17N3OS2/c1-8-6-9(12(13)17)7-11(14-8)15-10-2-4-18(16)5-3-10/h6-7,10H,2-5H2,1H3,(H2,13,17)(H,14,15) |
| InChIKey | JVQXGCUXXBKRBY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|