C10H14N4OS2 — CID 107548069
2-[(1-oxothian-4-yl)amino]pyrimidine-4-carbothioamide (PubChem CID 107548069) has the molecular formula C10H14N4OS2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-[(1-oxothian-4-yl)amino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[(1-oxothian-4-yl)amino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548069 |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-[(1-oxothian-4-yl)amino]pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(NC2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C10H14N4OS2/c11-9(16)8-1-4-12-10(14-8)13-7-2-5-17(15)6-3-7/h1,4,7H,2-3,5-6H2,(H2,11,16)(H,12,13,14) |
| InChIKey | XKSKMSJWYYUGTE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|