C14H20N4OS — CID 114767803
4-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]-N-cyclopropylbutanamide (PubChem CID 114767803) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 114767803 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]-N-cyclopropylbutanamide |
| SMILES | Cc1cc(C(N)=S)cc(NCCCC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C14H20N4OS/c1-9-7-10(14(15)20)8-12(17-9)16-6-2-3-13(19)18-11-4-5-11/h7-8,11H,2-6H2,1H3,(H2,15,20)(H,16,17)(H,18,19) |
| InChIKey | BLFITYBQIWGFCQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|