C13H18N4OS — CID 115488712
4-[(6-carbamothioyl-3-pyridinyl)amino]-N-cyclopropylbutanamide (PubChem CID 115488712) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-[(6-carbamothioyl-3-pyridinyl)amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(6-carbamothioyl-3-pyridinyl)amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 115488712 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-[(6-carbamothioyl-3-pyridinyl)amino]-N-cyclopropylbutanamide |
| SMILES | NC(=S)c1ccc(NCCCC(=O)NC2CC2)cn1 |
| InChI | InChI=1S/C13H18N4OS/c14-13(19)11-6-5-10(8-16-11)15-7-1-2-12(18)17-9-3-4-9/h5-6,8-9,15H,1-4,7H2,(H2,14,19)(H,17,18) |
| InChIKey | HXSOOIRGAJXWIU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|