C12H16N4O3 — CID 79400956
6-[[4-(cyclopropylamino)-4-oxobutyl]amino]pyrazine-2-carboxylic acid (PubChem CID 79400956) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 6-[[4-(cyclopropylamino)-4-oxobutyl]amino]pyrazine-2-carboxylic acid.
| Compound Name | 6-[[4-(cyclopropylamino)-4-oxobutyl]amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 79400956 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-[[4-(cyclopropylamino)-4-oxobutyl]amino]pyrazine-2-carboxylic acid |
| SMILES | O=C(CCCNc1cncc(C(=O)O)n1)NC1CC1 |
| InChI | InChI=1S/C12H16N4O3/c17-11(15-8-3-4-8)2-1-5-14-10-7-13-6-9(16-10)12(18)19/h6-8H,1-5H2,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | KUSOWGLIKZLRLH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|