C11H15IN4O — CID 79401058
N-cyclopropyl-4-[(5-iodopyrimidin-4-yl)amino]butanamide (PubChem CID 79401058) has the molecular formula C11H15IN4O and a molecular weight of 346.17 g/mol. Its IUPAC name is N-cyclopropyl-4-[(5-iodopyrimidin-4-yl)amino]butanamide.
| Compound Name | N-cyclopropyl-4-[(5-iodopyrimidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 79401058 |
| Molecular Formula | C11H15IN4O |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-cyclopropyl-4-[(5-iodopyrimidin-4-yl)amino]butanamide |
| SMILES | O=C(CCCNc1ncncc1I)NC1CC1 |
| InChI | InChI=1S/C11H15IN4O/c12-9-6-13-7-15-11(9)14-5-1-2-10(17)16-8-3-4-8/h6-8H,1-5H2,(H,16,17)(H,13,14,15) |
| InChIKey | GYWDDMXWVDHDLZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|