C12H14Cl3N3O — CID 102751454
N-cyclopropyl-4-[(3,5,6-trichloro-2-pyridinyl)amino]butanamide (PubChem CID 102751454) has the molecular formula C12H14Cl3N3O and a molecular weight of 322.62 g/mol. Its IUPAC name is N-cyclopropyl-4-[(3,5,6-trichloro-2-pyridinyl)amino]butanamide.
| Compound Name | N-cyclopropyl-4-[(3,5,6-trichloro-2-pyridinyl)amino]butanamide |
|---|---|
| PubChem CID | 102751454 |
| Molecular Formula | C12H14Cl3N3O |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-cyclopropyl-4-[(3,5,6-trichloro-2-pyridinyl)amino]butanamide |
| SMILES | O=C(CCCNc1nc(Cl)c(Cl)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C12H14Cl3N3O/c13-8-6-9(14)12(18-11(8)15)16-5-1-2-10(19)17-7-3-4-7/h6-7H,1-5H2,(H,16,18)(H,17,19) |
| InChIKey | AKBHOSQXKVWFAN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|