C13H21ClN6O — CID 80836242
4-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide (PubChem CID 80836242) has the molecular formula C13H21ClN6O and a molecular weight of 312.81 g/mol. Its IUPAC name is 4-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 80836242 |
| Molecular Formula | C13H21ClN6O |
| Molecular Weight | 312.81 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide |
| SMILES | CCCNc1nc(Cl)nc(NCCCC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C13H21ClN6O/c1-2-7-15-12-18-11(14)19-13(20-12)16-8-3-4-10(21)17-9-5-6-9/h9H,2-8H2,1H3,(H,17,21)(H2,15,16,18,19,20) |
| InChIKey | UUTZWBNWYNGMRT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|