C12H19ClN6O — CID 79401202
4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide (PubChem CID 79401202) has the molecular formula C12H19ClN6O and a molecular weight of 298.78 g/mol. Its IUPAC name is 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79401202 |
| Molecular Formula | C12H19ClN6O |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]-N-cyclopropylbutanamide |
| SMILES | CN(C)c1nc(Cl)nc(NCCCC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C12H19ClN6O/c1-19(2)12-17-10(13)16-11(18-12)14-7-3-4-9(20)15-8-5-6-8/h8H,3-7H2,1-2H3,(H,15,20)(H,14,16,17,18) |
| InChIKey | XKGSZOBVJOSJFU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|