C11H20ClN5O — CID 107324197
5-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 107324197) has the molecular formula C11H20ClN5O and a molecular weight of 273.77 g/mol. Its IUPAC name is 5-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107324197 |
| Molecular Formula | C11H20ClN5O |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 5-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | CCCNc1nc(Cl)nc(NCCCCCO)n1 |
| InChI | InChI=1S/C11H20ClN5O/c1-2-6-13-10-15-9(12)16-11(17-10)14-7-4-3-5-8-18/h18H,2-8H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | RSQHGQQJAZRBSG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|