C9H16ClN5O — CID 107855348
6-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]hexan-1-ol (PubChem CID 107855348) has the molecular formula C9H16ClN5O and a molecular weight of 245.71 g/mol. Its IUPAC name is 6-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]hexan-1-ol.
| Compound Name | 6-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 107855348 |
| Molecular Formula | C9H16ClN5O |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]hexan-1-ol |
| SMILES | Nc1nc(Cl)nc(NCCCCCCO)n1 |
| InChI | InChI=1S/C9H16ClN5O/c10-7-13-8(11)15-9(14-7)12-5-3-1-2-4-6-16/h16H,1-6H2,(H3,11,12,13,14,15) |
| InChIKey | CWSSGUDRAPOVMZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|