C18H33FN12O — CID 145427155
4-[[4-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butylamino]-6-(4-fluorobutylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol (PubChem CID 145427155) has the molecular formula C18H33FN12O and a molecular weight of 452.54 g/mol. Its IUPAC name is 4-[[4-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butylamino]-6-(4-fluorobutylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[4-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butylamino]-6-(4-fluorobutylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 145427155 |
| Molecular Formula | C18H33FN12O |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 4-[[4-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butylamino]-6-(4-fluorobutylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol |
| SMILES | Nc1nc(N)nc(NCCCCNc2nc(NCCCCO)nc(NCCCCF)n2)n1 |
| InChI | InChI=1S/C18H33FN12O/c19-7-1-2-8-23-16-29-17(31-18(30-16)25-11-5-6-12-32)24-10-4-3-9-22-15-27-13(20)26-14(21)28-15/h32H,1-12H2,(H5,20,21,22,26,27,28)(H3,23,24,25,29,30,31) |
| InChIKey | VXOLKLLPUBRKQD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 197.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|