C9H13N7O — CID 80772756
3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 80772756) has the molecular formula C9H13N7O and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 80772756 |
| Molecular Formula | C9H13N7O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | Nc1nc(NCCCO)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H13N7O/c10-7-13-8(12-2-1-5-17)15-9(14-7)16-4-3-11-6-16/h3-4,6,17H,1-2,5H2,(H3,10,12,13,14,15) |
| InChIKey | KWQTZJFZQYHFLK-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|