C11H17N7O2 — CID 80813959
6-imidazol-1-yl-2-N-[2-(2-methoxyethoxy)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 80813959) has the molecular formula C11H17N7O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-imidazol-1-yl-2-N-[2-(2-methoxyethoxy)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-imidazol-1-yl-2-N-[2-(2-methoxyethoxy)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80813959 |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 6-imidazol-1-yl-2-N-[2-(2-methoxyethoxy)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COCCOCCNc1nc(N)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H17N7O2/c1-19-6-7-20-5-3-14-10-15-9(12)16-11(17-10)18-4-2-13-8-18/h2,4,8H,3,5-7H2,1H3,(H3,12,14,15,16,17) |
| InChIKey | WBNSHGCXAMQEGX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|