C13H19N7O — CID 80818639
2-N-(2-cyclopentyloxyethyl)-6-imidazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80818639) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-N-(2-cyclopentyloxyethyl)-6-imidazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-cyclopentyloxyethyl)-6-imidazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80818639 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-N-(2-cyclopentyloxyethyl)-6-imidazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCCOC2CCCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H19N7O/c14-11-17-12(16-6-8-21-10-3-1-2-4-10)19-13(18-11)20-7-5-15-9-20/h5,7,9-10H,1-4,6,8H2,(H3,14,16,17,18,19) |
| InChIKey | HDGBGUDNEOYAGR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|