C9H14N8O2S — CID 80787090
N-[2-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide (PubChem CID 80787090) has the molecular formula C9H14N8O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[2-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80787090 |
| Molecular Formula | C9H14N8O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[2-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nc(N)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H14N8O2S/c1-20(18,19)13-3-2-12-8-14-7(10)15-9(16-8)17-5-4-11-6-17/h4-6,13H,2-3H2,1H3,(H3,10,12,14,15,16) |
| InChIKey | HTWXLEOZAZJVON-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|