C9H11ClN8O — CID 83114169
2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethylurea (PubChem CID 83114169) has the molecular formula C9H11ClN8O and a molecular weight of 282.70 g/mol. Its IUPAC name is 2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethylurea.
| Compound Name | 2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83114169 |
| Molecular Formula | C9H11ClN8O |
| Molecular Weight | 282.70 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1nc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H11ClN8O/c10-6-15-8(14-2-1-13-7(11)19)17-9(16-6)18-4-3-12-5-18/h3-5H,1-2H2,(H3,11,13,19)(H,14,15,16,17) |
| InChIKey | LBYHMHNDAQTVDS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.70 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|