C10H9ClN6 — CID 106194902
N-but-3-ynyl-4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 106194902) has the molecular formula C10H9ClN6 and a molecular weight of 248.68 g/mol. Its IUPAC name is N-but-3-ynyl-4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-but-3-ynyl-4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106194902 |
| Molecular Formula | C10H9ClN6 |
| Molecular Weight | 248.68 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-but-3-ynyl-4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | C#CCCNc1nc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H9ClN6/c1-2-3-4-13-9-14-8(11)15-10(16-9)17-6-5-12-7-17/h1,5-7H,3-4H2,(H,13,14,15,16) |
| InChIKey | WGKBFQZMHTUCCE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.68 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|