C9H8ClN7 — CID 106194914
N-but-3-ynyl-4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 106194914) has the molecular formula C9H8ClN7 and a molecular weight of 249.66 g/mol. Its IUPAC name is N-but-3-ynyl-4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-but-3-ynyl-4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106194914 |
| Molecular Formula | C9H8ClN7 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-but-3-ynyl-4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | C#CCCNc1nc(Cl)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H8ClN7/c1-2-3-4-12-8-14-7(10)15-9(16-8)17-6-11-5-13-17/h1,5-6H,3-4H2,(H,12,14,15,16) |
| InChIKey | PZBAPWBSYPOYQN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|