C9H11ClN8O2 — CID 106240091
2-[2-[[4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetamide (PubChem CID 106240091) has the molecular formula C9H11ClN8O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 2-[2-[[4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetamide.
| Compound Name | 2-[2-[[4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240091 |
| Molecular Formula | C9H11ClN8O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[2-[[4-chloro-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1nc(Cl)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H11ClN8O2/c10-7-15-8(13-1-2-20-3-6(11)19)17-9(16-7)18-5-12-4-14-18/h4-5H,1-3H2,(H2,11,19)(H,13,15,16,17) |
| InChIKey | VMIHXYICAIBRBP-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|