C8H10ClN7S — CID 63959659
4-chloro-N-(2-methylsulfanylethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 63959659) has the molecular formula C8H10ClN7S and a molecular weight of 271.74 g/mol. Its IUPAC name is 4-chloro-N-(2-methylsulfanylethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2-methylsulfanylethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63959659 |
| Molecular Formula | C8H10ClN7S |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-chloro-N-(2-methylsulfanylethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CSCCNc1nc(Cl)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C8H10ClN7S/c1-17-3-2-11-7-13-6(9)14-8(15-7)16-5-10-4-12-16/h4-5H,2-3H2,1H3,(H,11,13,14,15) |
| InChIKey | WPDHEBLOARYNJA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|