C11H18N8S — CID 80839383
2-N-(2-methylsulfanylethyl)-4-N-propyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80839383) has the molecular formula C11H18N8S and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-N-(2-methylsulfanylethyl)-4-N-propyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methylsulfanylethyl)-4-N-propyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80839383 |
| Molecular Formula | C11H18N8S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-N-(2-methylsulfanylethyl)-4-N-propyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NCCSC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H18N8S/c1-3-4-13-9-16-10(14-5-6-20-2)18-11(17-9)19-8-12-7-15-19/h7-8H,3-6H2,1-2H3,(H2,13,14,16,17,18) |
| InChIKey | KWKZBCGZUMCSGC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|