C11H18N8 — CID 80765612
2-N,4-N-dipropyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80765612) has the molecular formula C11H18N8 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-N,4-N-dipropyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dipropyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80765612 |
| Molecular Formula | C11H18N8 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-N,4-N-dipropyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NCCC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H18N8/c1-3-5-13-9-16-10(14-6-4-2)18-11(17-9)19-8-12-7-15-19/h7-8H,3-6H2,1-2H3,(H2,13,14,16,17,18) |
| InChIKey | MOTALEJCFSHTTE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |