C10H12N10 — CID 80853504
N-propyl-4,6-bis(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80853504) has the molecular formula C10H12N10 and a molecular weight of 272.28 g/mol. Its IUPAC name is N-propyl-4,6-bis(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-propyl-4,6-bis(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80853504 |
| Molecular Formula | C10H12N10 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-propyl-4,6-bis(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(-n2cncn2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H12N10/c1-2-3-13-8-16-9(19-6-11-4-14-19)18-10(17-8)20-7-12-5-15-20/h4-7H,2-3H2,1H3,(H,13,16,17,18) |
| InChIKey | JTVXZQLDDVPWIA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |