C11H11ClN6 — CID 114156803
4-chloro-6-imidazol-1-yl-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine (PubChem CID 114156803) has the molecular formula C11H11ClN6 and a molecular weight of 262.70 g/mol. Its IUPAC name is 4-chloro-6-imidazol-1-yl-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-imidazol-1-yl-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114156803 |
| Molecular Formula | C11H11ClN6 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-chloro-6-imidazol-1-yl-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine |
| SMILES | C#CCC(C)Nc1nc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H11ClN6/c1-3-4-8(2)14-10-15-9(12)16-11(17-10)18-6-5-13-7-18/h1,5-8H,4H2,2H3,(H,14,15,16,17) |
| InChIKey | SRBZXXNHTSEIJR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|