C10H13ClN6O2 — CID 62864873
2-[2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol (PubChem CID 62864873) has the molecular formula C10H13ClN6O2 and a molecular weight of 284.71 g/mol. Its IUPAC name is 2-[2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 62864873 |
| Molecular Formula | C10H13ClN6O2 |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[2-[(4-chloro-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H13ClN6O2/c11-8-14-9(13-2-5-19-6-4-18)16-10(15-8)17-3-1-12-7-17/h1,3,7,18H,2,4-6H2,(H,13,14,15,16) |
| InChIKey | FQQQHGMYXDNKCX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|