C12H20ClN5O2 — CID 62864714
2-[2-[(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol (PubChem CID 62864714) has the molecular formula C12H20ClN5O2 and a molecular weight of 301.78 g/mol. Its IUPAC name is 2-[2-[(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 62864714 |
| Molecular Formula | C12H20ClN5O2 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[2-[(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nc(Cl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H20ClN5O2/c13-10-15-11(14-4-8-20-9-7-19)17-12(16-10)18-5-2-1-3-6-18/h19H,1-9H2,(H,14,15,16,17) |
| InChIKey | BVCKZXTXNUDYTM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|