C10H19ClN6 — CID 158442311
N'-(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)methanediamine;methane (PubChem CID 158442311) has the molecular formula C10H19ClN6 and a molecular weight of 258.76 g/mol. Its IUPAC name is N'-(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)methanediamine;methane.
| Compound Name | N'-(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)methanediamine;methane |
|---|---|
| PubChem CID | 158442311 |
| Molecular Formula | C10H19ClN6 |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N'-(4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-yl)methanediamine;methane |
| SMILES | C.NCNc1nc(Cl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C9H15ClN6.CH4/c10-7-13-8(12-6-11)15-9(14-7)16-4-2-1-3-5-16;/h1-6,11H2,(H,12,13,14,15);1H4 |
| InChIKey | HCYWNZKIFUBVTH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|