C12H16ClN5 — CID 114156794
N-but-2-ynyl-4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 114156794) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is N-but-2-ynyl-4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-but-2-ynyl-4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114156794 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-but-2-ynyl-4-chloro-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CC#CCNc1nc(Cl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H16ClN5/c1-2-3-7-14-11-15-10(13)16-12(17-11)18-8-5-4-6-9-18/h4-9H2,1H3,(H,14,15,16,17) |
| InChIKey | SZTWEDOABURTGX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|