C13H18ClN5 — CID 114156702
4-chloro-N-(2-methylbut-3-yn-2-yl)-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 114156702) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-chloro-N-(2-methylbut-3-yn-2-yl)-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2-methylbut-3-yn-2-yl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114156702 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-chloro-N-(2-methylbut-3-yn-2-yl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | C#CC(C)(C)Nc1nc(Cl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C13H18ClN5/c1-4-13(2,3)18-11-15-10(14)16-12(17-11)19-8-6-5-7-9-19/h1H,5-9H2,2-3H3,(H,15,16,17,18) |
| InChIKey | ONMYBFLJCQQIPK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|