C15H26N6 — CID 974630
N-tert-butyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 974630) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is N-tert-butyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-tert-butyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 974630 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | N-tert-butyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)Nc1nc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H26N6/c1-15(2,3)19-12-16-13(20-8-4-5-9-20)18-14(17-12)21-10-6-7-11-21/h4-11H2,1-3H3,(H,16,17,18,19) |
| InChIKey | JKMMTFLYXNGCTP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |