C18H30N6 — CID 2827031
2,4,6-tri(piperidin-1-yl)-1,3,5-triazine (PubChem CID 2827031) has the molecular formula C18H30N6 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2,4,6-tri(piperidin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tri(piperidin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 2827031 |
| Molecular Formula | C18H30N6 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 2,4,6-tri(piperidin-1-yl)-1,3,5-triazine |
| SMILES | C1CCN(c2nc(N3CCCCC3)nc(N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C18H30N6/c1-4-10-22(11-5-1)16-19-17(23-12-6-2-7-13-23)21-18(20-16)24-14-8-3-9-15-24/h1-15H2 |
| InChIKey | DBUDAKFVUSPQTP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |