C11H13N3O4 — CID 66490570
2-piperidin-1-ylpyrimidine-4,6-dicarboxylic acid (PubChem CID 66490570) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-piperidin-1-ylpyrimidine-4,6-dicarboxylic acid.
| Compound Name | 2-piperidin-1-ylpyrimidine-4,6-dicarboxylic acid |
|---|---|
| PubChem CID | 66490570 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-piperidin-1-ylpyrimidine-4,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C11H13N3O4/c15-9(16)7-6-8(10(17)18)13-11(12-7)14-4-2-1-3-5-14/h6H,1-5H2,(H,15,16)(H,17,18) |
| InChIKey | YETRLWZTGHMSJQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |