C13H22N6O — CID 80764187
4-(azepan-1-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 80764187) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(azepan-1-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(azepan-1-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80764187 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 4-(azepan-1-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCCCCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H22N6O/c14-11-15-12(18-5-3-1-2-4-6-18)17-13(16-11)19-7-9-20-10-8-19/h1-10H2,(H2,14,15,16,17) |
| InChIKey | JTZXQJSYFDPMCW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |